C17H24N6O2 — CID 75509073
3-[4-[(6-ethoxypyrimidin-4-yl)amino]piperidin-1-yl]-1-ethylpyrazin-2-one (PubChem CID 75509073) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-[4-[(6-ethoxypyrimidin-4-yl)amino]piperidin-1-yl]-1-ethylpyrazin-2-one.
| Compound Name | 3-[4-[(6-ethoxypyrimidin-4-yl)amino]piperidin-1-yl]-1-ethylpyrazin-2-one |
|---|---|
| PubChem CID | 75509073 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-[4-[(6-ethoxypyrimidin-4-yl)amino]piperidin-1-yl]-1-ethylpyrazin-2-one |
| SMILES | CCOc1cc(NC2CCN(c3nccn(CC)c3=O)CC2)ncn1 |
| InChI | InChI=1S/C17H24N6O2/c1-3-22-10-7-18-16(17(22)24)23-8-5-13(6-9-23)21-14-11-15(25-4-2)20-12-19-14/h7,10-13H,3-6,8-9H2,1-2H3,(H,19,20,21) |
| InChIKey | BZFOYAOIWRHEJB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |