C12H17F3N4O3S — CID 133490993
6-ethoxy-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrimidin-4-amine (PubChem CID 133490993) has the molecular formula C12H17F3N4O3S and a molecular weight of 354.35 g/mol. Its IUPAC name is 6-ethoxy-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrimidin-4-amine.
| Compound Name | 6-ethoxy-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133490993 |
| Molecular Formula | C12H17F3N4O3S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 6-ethoxy-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrimidin-4-amine |
| SMILES | CCOc1cc(NC2CCN(S(=O)(=O)C(F)(F)F)CC2)ncn1 |
| InChI | InChI=1S/C12H17F3N4O3S/c1-2-22-11-7-10(16-8-17-11)18-9-3-5-19(6-4-9)23(20,21)12(13,14)15/h7-9H,2-6H2,1H3,(H,16,17,18) |
| InChIKey | TVYIKYMLRRKTDD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |