C16H23F3N4O3S — CID 133490995
6-(cyclopentylmethoxy)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrazin-2-amine (PubChem CID 133490995) has the molecular formula C16H23F3N4O3S and a molecular weight of 408.45 g/mol. Its IUPAC name is 6-(cyclopentylmethoxy)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrazin-2-amine.
| Compound Name | 6-(cyclopentylmethoxy)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 133490995 |
| Molecular Formula | C16H23F3N4O3S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 6-(cyclopentylmethoxy)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrazin-2-amine |
| SMILES | O=S(=O)(N1CCC(Nc2cncc(OCC3CCCC3)n2)CC1)C(F)(F)F |
| InChI | InChI=1S/C16H23F3N4O3S/c17-16(18,19)27(24,25)23-7-5-13(6-8-23)21-14-9-20-10-15(22-14)26-11-12-3-1-2-4-12/h9-10,12-13H,1-8,11H2,(H,21,22) |
| InChIKey | HPDXNMXBNHAYLV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |