C17H24N4O2 — CID 128988050
N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-3-methyl-1H-pyrrole-2-carboxamide (PubChem CID 128988050) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-3-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-3-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 128988050 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-3-methyl-1H-pyrrole-2-carboxamide |
| SMILES | CCn1ccnc1C(NC(=O)c1[nH]ccc1C)C1CCOCC1 |
| InChI | InChI=1S/C17H24N4O2/c1-3-21-9-8-19-16(21)15(13-5-10-23-11-6-13)20-17(22)14-12(2)4-7-18-14/h4,7-9,13,15,18H,3,5-6,10-11H2,1-2H3,(H,20,22) |
| InChIKey | PXRPZLJYBNZWJN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |