C23H31N5O3 — CID 164638768
4-benzoyl-N-[(S)-(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]piperazine-1-carboxamide (PubChem CID 164638768) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-benzoyl-N-[(S)-(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-benzoyl-N-[(S)-(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 164638768 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 4-benzoyl-N-[(S)-(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]piperazine-1-carboxamide |
| SMILES | CCn1ccnc1[C@@H](NC(=O)N1CCN(C(=O)c2ccccc2)CC1)C1CCOCC1 |
| InChI | InChI=1S/C23H31N5O3/c1-2-26-11-10-24-21(26)20(18-8-16-31-17-9-18)25-23(30)28-14-12-27(13-15-28)22(29)19-6-4-3-5-7-19/h3-7,10-11,18,20H,2,8-9,12-17H2,1H3,(H,25,30)/t20-/m0/s1 |
| InChIKey | BFSGMBMWGMZTAB-FQEVSTJZSA-N |
| XLogP | 2.54 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |