C13H20FN3O2 — CID 125136142
6-ethyl-5-fluoro-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]pyrimidin-4-amine (PubChem CID 125136142) has the molecular formula C13H20FN3O2 and a molecular weight of 269.32 g/mol. Its IUPAC name is 6-ethyl-5-fluoro-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]pyrimidin-4-amine.
| Compound Name | 6-ethyl-5-fluoro-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 125136142 |
| Molecular Formula | C13H20FN3O2 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 6-ethyl-5-fluoro-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]pyrimidin-4-amine |
| SMILES | CCc1ncnc(N[C@@H](C)CO[C@@H]2CCOC2)c1F |
| InChI | InChI=1S/C13H20FN3O2/c1-3-11-12(14)13(16-8-15-11)17-9(2)6-19-10-4-5-18-7-10/h8-10H,3-7H2,1-2H3,(H,15,16,17)/t9-,10+/m0/s1 |
| InChIKey | GVDUEVDUIFBXTE-VHSXEESVSA-N |
| XLogP | 1.78 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |