C13H18F2N2O3 — CID 97138326
5-(difluoromethoxy)-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]pyridin-2-amine (PubChem CID 97138326) has the molecular formula C13H18F2N2O3 and a molecular weight of 288.29 g/mol. Its IUPAC name is 5-(difluoromethoxy)-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]pyridin-2-amine.
| Compound Name | 5-(difluoromethoxy)-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 97138326 |
| Molecular Formula | C13H18F2N2O3 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-(difluoromethoxy)-N-[(2S)-1-[(3R)-oxolan-3-yl]oxypropan-2-yl]pyridin-2-amine |
| SMILES | C[C@@H](CO[C@@H]1CCOC1)Nc1ccc(OC(F)F)cn1 |
| InChI | InChI=1S/C13H18F2N2O3/c1-9(7-19-11-4-5-18-8-11)17-12-3-2-10(6-16-12)20-13(14)15/h2-3,6,9,11,13H,4-5,7-8H2,1H3,(H,16,17)/t9-,11+/m0/s1 |
| InChIKey | DSHFAJDNMHUDTE-GXSJLCMTSA-N |
| XLogP | 2.29 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |