C16H18ClN3O3 — CID 128983869
(2S,4S)-1-[2-(6-chloroindol-1-yl)acetyl]-4-methoxypyrrolidine-2-carboxamide (PubChem CID 128983869) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is (2S,4S)-1-[2-(6-chloroindol-1-yl)acetyl]-4-methoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[2-(6-chloroindol-1-yl)acetyl]-4-methoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 128983869 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (2S,4S)-1-[2-(6-chloroindol-1-yl)acetyl]-4-methoxypyrrolidine-2-carboxamide |
| SMILES | CO[C@H]1C[C@@H](C(N)=O)N(C(=O)Cn2ccc3ccc(Cl)cc32)C1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-23-12-7-14(16(18)22)20(8-12)15(21)9-19-5-4-10-2-3-11(17)6-13(10)19/h2-6,12,14H,7-9H2,1H3,(H2,18,22)/t12-,14-/m0/s1 |
| InChIKey | RMCDYQTUHBORJT-JSGCOSHPSA-N |
| XLogP | 1.40 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |