C13H14ClFN2O3 — CID 128983598
(2S,4S)-1-(2-chloro-4-fluorobenzoyl)-4-methoxypyrrolidine-2-carboxamide (PubChem CID 128983598) has the molecular formula C13H14ClFN2O3 and a molecular weight of 300.72 g/mol. Its IUPAC name is (2S,4S)-1-(2-chloro-4-fluorobenzoyl)-4-methoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-(2-chloro-4-fluorobenzoyl)-4-methoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 128983598 |
| Molecular Formula | C13H14ClFN2O3 |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (2S,4S)-1-(2-chloro-4-fluorobenzoyl)-4-methoxypyrrolidine-2-carboxamide |
| SMILES | CO[C@H]1C[C@@H](C(N)=O)N(C(=O)c2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C13H14ClFN2O3/c1-20-8-5-11(12(16)18)17(6-8)13(19)9-3-2-7(15)4-10(9)14/h2-4,8,11H,5-6H2,1H3,(H2,16,18)/t8-,11-/m0/s1 |
| InChIKey | YDIRPAJCWLYNEX-KWQFWETISA-N |
| XLogP | 1.19 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |