C16H23NO4 — CID 128984916
1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]-3-phenylmethoxypropan-1-one (PubChem CID 128984916) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]-3-phenylmethoxypropan-1-one.
| Compound Name | 1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]-3-phenylmethoxypropan-1-one |
|---|---|
| PubChem CID | 128984916 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]-3-phenylmethoxypropan-1-one |
| SMILES | CO[C@@H]1C[C@@H](CO)N(C(=O)CCOCc2ccccc2)C1 |
| InChI | InChI=1S/C16H23NO4/c1-20-15-9-14(11-18)17(10-15)16(19)7-8-21-12-13-5-3-2-4-6-13/h2-6,14-15,18H,7-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | HDODWGBHILQPSV-LSDHHAIUSA-N |
| XLogP | 1.20 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|