C9H7Cl2N3O — CID 12898506
2-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazol-3-one (PubChem CID 12898506) has the molecular formula C9H7Cl2N3O and a molecular weight of 244.08 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazol-3-one.
| Compound Name | 2-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 12898506 |
| Molecular Formula | C9H7Cl2N3O |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazol-3-one |
| SMILES | Cn1cnn(-c2ccc(Cl)cc2Cl)c1=O |
| InChI | InChI=1S/C9H7Cl2N3O/c1-13-5-12-14(9(13)15)8-3-2-6(10)4-7(8)11/h2-5H,1H3 |
| InChIKey | MOODPVKJJRAMBC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |