C15H22N2O4 — CID 128987031
(2R,3S)-4-[2-(3-methoxyphenoxy)ethyl]-2-methylmorpholine-3-carboxamide (PubChem CID 128987031) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is (2R,3S)-4-[2-(3-methoxyphenoxy)ethyl]-2-methylmorpholine-3-carboxamide.
| Compound Name | (2R,3S)-4-[2-(3-methoxyphenoxy)ethyl]-2-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 128987031 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (2R,3S)-4-[2-(3-methoxyphenoxy)ethyl]-2-methylmorpholine-3-carboxamide |
| SMILES | COc1cccc(OCCN2CCO[C@H](C)[C@H]2C(N)=O)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-11-14(15(16)18)17(6-8-20-11)7-9-21-13-5-3-4-12(10-13)19-2/h3-5,10-11,14H,6-9H2,1-2H3,(H2,16,18)/t11-,14+/m1/s1 |
| InChIKey | JYCOMBHHWALPCH-RISCZKNCSA-N |
| XLogP | 0.65 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |