C12H19N3O2 — CID 128987106
2-[(3S,4S)-3-methyl-4-(morpholine-4-carbonyl)pyrrolidin-1-yl]acetonitrile (PubChem CID 128987106) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[(3S,4S)-3-methyl-4-(morpholine-4-carbonyl)pyrrolidin-1-yl]acetonitrile.
| Compound Name | 2-[(3S,4S)-3-methyl-4-(morpholine-4-carbonyl)pyrrolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 128987106 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-[(3S,4S)-3-methyl-4-(morpholine-4-carbonyl)pyrrolidin-1-yl]acetonitrile |
| SMILES | C[C@@H]1CN(CC#N)C[C@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H19N3O2/c1-10-8-14(3-2-13)9-11(10)12(16)15-4-6-17-7-5-15/h10-11H,3-9H2,1H3/t10-,11-/m1/s1 |
| InChIKey | CJDXCLLMYITTHN-GHMZBOCLSA-N |
| XLogP | -0.06 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|