C19H19F2NO3 — CID 128990222
3-(2-fluorophenoxy)-1-[2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]propan-1-one (PubChem CID 128990222) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is 3-(2-fluorophenoxy)-1-[2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(2-fluorophenoxy)-1-[2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 128990222 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-(2-fluorophenoxy)-1-[2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]propan-1-one |
| SMILES | O=C(CCOc1ccccc1F)N1CC(O)CC1c1cccc(F)c1 |
| InChI | InChI=1S/C19H19F2NO3/c20-14-5-3-4-13(10-14)17-11-15(23)12-22(17)19(24)8-9-25-18-7-2-1-6-16(18)21/h1-7,10,15,17,23H,8-9,11-12H2 |
| InChIKey | OJJDRHNIAZFILH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |