C18H31N5O3S — CID 128992804
N-ethyl-1-[6-[(2-propan-2-yloxan-3-yl)amino]pyrimidin-4-yl]pyrrolidine-3-sulfonamide (PubChem CID 128992804) has the molecular formula C18H31N5O3S and a molecular weight of 397.55 g/mol. Its IUPAC name is N-ethyl-1-[6-[(2-propan-2-yloxan-3-yl)amino]pyrimidin-4-yl]pyrrolidine-3-sulfonamide.
| Compound Name | N-ethyl-1-[6-[(2-propan-2-yloxan-3-yl)amino]pyrimidin-4-yl]pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 128992804 |
| Molecular Formula | C18H31N5O3S |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N-ethyl-1-[6-[(2-propan-2-yloxan-3-yl)amino]pyrimidin-4-yl]pyrrolidine-3-sulfonamide |
| SMILES | CCNS(=O)(=O)C1CCN(c2cc(NC3CCCOC3C(C)C)ncn2)C1 |
| InChI | InChI=1S/C18H31N5O3S/c1-4-21-27(24,25)14-7-8-23(11-14)17-10-16(19-12-20-17)22-15-6-5-9-26-18(15)13(2)3/h10,12-15,18,21H,4-9,11H2,1-3H3,(H,19,20,22) |
| InChIKey | LLRQPVDOVNHTFU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |