C16H29N5O3S — CID 129007971
N-[3-[[6-[(2-propan-2-yloxan-3-yl)amino]pyrimidin-4-yl]amino]propyl]methanesulfonamide (PubChem CID 129007971) has the molecular formula C16H29N5O3S and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[3-[[6-[(2-propan-2-yloxan-3-yl)amino]pyrimidin-4-yl]amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[6-[(2-propan-2-yloxan-3-yl)amino]pyrimidin-4-yl]amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 129007971 |
| Molecular Formula | C16H29N5O3S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[3-[[6-[(2-propan-2-yloxan-3-yl)amino]pyrimidin-4-yl]amino]propyl]methanesulfonamide |
| SMILES | CC(C)C1OCCCC1Nc1cc(NCCCNS(C)(=O)=O)ncn1 |
| InChI | InChI=1S/C16H29N5O3S/c1-12(2)16-13(6-4-9-24-16)21-15-10-14(18-11-19-15)17-7-5-8-20-25(3,22)23/h10-13,16,20H,4-9H2,1-3H3,(H2,17,18,19,21) |
| InChIKey | BJGYVLSIFAUVMK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|