C18H31N3O — CID 128993951
2-[1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]pyrrolidin-2-yl]cyclohexan-1-ol (PubChem CID 128993951) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is 2-[1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]pyrrolidin-2-yl]cyclohexan-1-ol.
| Compound Name | 2-[1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]pyrrolidin-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 128993951 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | 2-[1-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]pyrrolidin-2-yl]cyclohexan-1-ol |
| SMILES | CC(C)Cn1cc(CN2CCCC2C2CCCCC2O)cn1 |
| InChI | InChI=1S/C18H31N3O/c1-14(2)11-21-13-15(10-19-21)12-20-9-5-7-17(20)16-6-3-4-8-18(16)22/h10,13-14,16-18,22H,3-9,11-12H2,1-2H3 |
| InChIKey | DNRHGOMEDGTOBT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |