C18H28N4O2S — CID 128996001
N-cyclobutyl-N-[1-(2-cyclopropylpyrimidin-4-yl)azepan-4-yl]methanesulfonamide (PubChem CID 128996001) has the molecular formula C18H28N4O2S and a molecular weight of 364.52 g/mol. Its IUPAC name is N-cyclobutyl-N-[1-(2-cyclopropylpyrimidin-4-yl)azepan-4-yl]methanesulfonamide.
| Compound Name | N-cyclobutyl-N-[1-(2-cyclopropylpyrimidin-4-yl)azepan-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 128996001 |
| Molecular Formula | C18H28N4O2S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-cyclobutyl-N-[1-(2-cyclopropylpyrimidin-4-yl)azepan-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(C1CCC1)C1CCCN(c2ccnc(C3CC3)n2)CC1 |
| InChI | InChI=1S/C18H28N4O2S/c1-25(23,24)22(15-4-2-5-15)16-6-3-12-21(13-10-16)17-9-11-19-18(20-17)14-7-8-14/h9,11,14-16H,2-8,10,12-13H2,1H3 |
| InChIKey | JLFJRFDTWMXSAK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |