C16H19ClN6O — CID 171998702
4-chloro-5-[4-(2-cyclopropylpyrimidin-4-yl)piperazin-1-yl]-2-methylpyridazin-3-one (PubChem CID 171998702) has the molecular formula C16H19ClN6O and a molecular weight of 346.82 g/mol. Its IUPAC name is 4-chloro-5-[4-(2-cyclopropylpyrimidin-4-yl)piperazin-1-yl]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[4-(2-cyclopropylpyrimidin-4-yl)piperazin-1-yl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 171998702 |
| Molecular Formula | C16H19ClN6O |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 4-chloro-5-[4-(2-cyclopropylpyrimidin-4-yl)piperazin-1-yl]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(N2CCN(c3ccnc(C4CC4)n3)CC2)c(Cl)c1=O |
| InChI | InChI=1S/C16H19ClN6O/c1-21-16(24)14(17)12(10-19-21)22-6-8-23(9-7-22)13-4-5-18-15(20-13)11-2-3-11/h4-5,10-11H,2-3,6-9H2,1H3 |
| InChIKey | PIKNOELKGIOPIW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |