C13H15ClN6O — CID 171998786
4-chloro-2-methyl-5-(4-pyrimidin-4-ylpiperazin-1-yl)pyridazin-3-one (PubChem CID 171998786) has the molecular formula C13H15ClN6O and a molecular weight of 306.76 g/mol. Its IUPAC name is 4-chloro-2-methyl-5-(4-pyrimidin-4-ylpiperazin-1-yl)pyridazin-3-one.
| Compound Name | 4-chloro-2-methyl-5-(4-pyrimidin-4-ylpiperazin-1-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 171998786 |
| Molecular Formula | C13H15ClN6O |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-chloro-2-methyl-5-(4-pyrimidin-4-ylpiperazin-1-yl)pyridazin-3-one |
| SMILES | Cn1ncc(N2CCN(c3ccncn3)CC2)c(Cl)c1=O |
| InChI | InChI=1S/C13H15ClN6O/c1-18-13(21)12(14)10(8-17-18)19-4-6-20(7-5-19)11-2-3-15-9-16-11/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | BRPZIHRJYSNXSO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |