C16H19ClN4O — CID 97226291
5-[(3S)-3-anilinopiperidin-1-yl]-4-chloro-2-methylpyridazin-3-one (PubChem CID 97226291) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is 5-[(3S)-3-anilinopiperidin-1-yl]-4-chloro-2-methylpyridazin-3-one.
| Compound Name | 5-[(3S)-3-anilinopiperidin-1-yl]-4-chloro-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 97226291 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 5-[(3S)-3-anilinopiperidin-1-yl]-4-chloro-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(N2CCC[C@H](Nc3ccccc3)C2)c(Cl)c1=O |
| InChI | InChI=1S/C16H19ClN4O/c1-20-16(22)15(17)14(10-18-20)21-9-5-8-13(11-21)19-12-6-3-2-4-7-12/h2-4,6-7,10,13,19H,5,8-9,11H2,1H3/t13-/m0/s1 |
| InChIKey | KOJVVFCVFOMEDO-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |