C17H20ClN3O2 — CID 133308219
4-chloro-2-methyl-5-[3-(phenoxymethyl)piperidin-1-yl]pyridazin-3-one (PubChem CID 133308219) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 4-chloro-2-methyl-5-[3-(phenoxymethyl)piperidin-1-yl]pyridazin-3-one.
| Compound Name | 4-chloro-2-methyl-5-[3-(phenoxymethyl)piperidin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 133308219 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 4-chloro-2-methyl-5-[3-(phenoxymethyl)piperidin-1-yl]pyridazin-3-one |
| SMILES | Cn1ncc(N2CCCC(COc3ccccc3)C2)c(Cl)c1=O |
| InChI | InChI=1S/C17H20ClN3O2/c1-20-17(22)16(18)15(10-19-20)21-9-5-6-13(11-21)12-23-14-7-3-2-4-8-14/h2-4,7-8,10,13H,5-6,9,11-12H2,1H3 |
| InChIKey | GFQLRDUSLJCHGI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |