About N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide
N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide (PubChem CID 128996332) has the molecular formula C16H25F3N2O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide.
Molecular Properties
| Compound Name | N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide |
| PubChem CID | 128996332 |
| Molecular Formula | C16H25F3N2O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide |
| SMILES | CC(=O)N(C1CCC1)C1CCCN(C(=O)CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C16H25F3N2O2/c1-12(22)21(13-4-2-5-13)14-6-3-10-20(11-8-14)15(23)7-9-16(17,18)19/h13-14H,2-11H2,1H3 |
| InChIKey | IIVJGHZPGWNVTM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide?
The IUPAC name of N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide (CID 128996332) is N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide.
What is the SMILES notation for N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide?
The canonical SMILES for N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide is CC(=O)N(C1CCC1)C1CCCN(C(=O)CCC(F)(F)F)CC1.
What is the InChIKey of N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide?
The InChIKey is IIVJGHZPGWNVTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25F3N2O2/c1-12(22)21(13-4-2-5-13)14-6-3-10-20(11-8-14)15(23)7-9-16(17,18)19/h13-14H,2-11H2,1H3.
What are the key properties of N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide?
N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide has a molecular weight of 334.38 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-N-[1-(4,4,4-trifluorobutanoyl)azepan-4-yl]acetamide is sourced from PubChem (CID 128996332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).