C15H26N4O2 — CID 128998802
1-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-3-(2-pyrazol-1-ylethyl)urea (PubChem CID 128998802) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-3-(2-pyrazol-1-ylethyl)urea.
| Compound Name | 1-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-3-(2-pyrazol-1-ylethyl)urea |
|---|---|
| PubChem CID | 128998802 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-3-(2-pyrazol-1-ylethyl)urea |
| SMILES | CC(C)(C)[C@H]1OCC[C@@H]1CNC(=O)NCCn1cccn1 |
| InChI | InChI=1S/C15H26N4O2/c1-15(2,3)13-12(5-10-21-13)11-17-14(20)16-7-9-19-8-4-6-18-19/h4,6,8,12-13H,5,7,9-11H2,1-3H3,(H2,16,17,20)/t12-,13+/m1/s1 |
| InChIKey | NQNFEHGYSQQJHS-OLZOCXBDSA-N |
| XLogP | 1.63 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |