About N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide
N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide (PubChem CID 129001970) has the molecular formula C16H27N3O2
and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide |
| PubChem CID | 129001970 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide |
| SMILES | CCCn1cc(C(=O)NC[C@H]2CCO[C@@H]2C(C)(C)C)cn1 |
| InChI | InChI=1S/C16H27N3O2/c1-5-7-19-11-13(10-18-19)15(20)17-9-12-6-8-21-14(12)16(2,3)4/h10-12,14H,5-9H2,1-4H3,(H,17,20)/t12-,14+/m1/s1 |
| InChIKey | BQQGWQIZJYBZDK-OCCSQVGLSA-N |
| XLogP | 2.47 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide?
The IUPAC name of N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide (CID 129001970) is N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide.
What is the SMILES notation for N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide?
The canonical SMILES for N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide is CCCn1cc(C(=O)NC[C@H]2CCO[C@@H]2C(C)(C)C)cn1.
What is the InChIKey of N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide?
The InChIKey is BQQGWQIZJYBZDK-OCCSQVGLSA-N. The full InChI is InChI=1S/C16H27N3O2/c1-5-7-19-11-13(10-18-19)15(20)17-9-12-6-8-21-14(12)16(2,3)4/h10-12,14H,5-9H2,1-4H3,(H,17,20)/t12-,14+/m1/s1.
What are the key properties of N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide?
N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide has a molecular weight of 293.41 g/mol, XLogP of 2.47, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-1-propylpyrazole-4-carboxamide is sourced from PubChem (CID 129001970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).