C15H22FN3O2 — CID 128999282
1-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-3-(3-fluoro-4-pyridinyl)urea (PubChem CID 128999282) has the molecular formula C15H22FN3O2 and a molecular weight of 295.36 g/mol. Its IUPAC name is 1-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-3-(3-fluoro-4-pyridinyl)urea.
| Compound Name | 1-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-3-(3-fluoro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 128999282 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 1-[[(2S,3R)-2-tert-butyloxolan-3-yl]methyl]-3-(3-fluoro-4-pyridinyl)urea |
| SMILES | CC(C)(C)[C@H]1OCC[C@@H]1CNC(=O)Nc1ccncc1F |
| InChI | InChI=1S/C15H22FN3O2/c1-15(2,3)13-10(5-7-21-13)8-18-14(20)19-12-4-6-17-9-11(12)16/h4,6,9-10,13H,5,7-8H2,1-3H3,(H2,17,18,19,20)/t10-,13+/m1/s1 |
| InChIKey | BJBNRXWMWMAHPF-MFKMUULPSA-N |
| XLogP | 2.79 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |