About 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide
4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide (PubChem CID 129001553) has the molecular formula C14H19N5O2S
and a molecular weight of 321.41 g/mol. Its IUPAC name is 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide |
| PubChem CID | 129001553 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)N[C@H]1CCO[C@@H]1c1cnn(CC)c1 |
| InChI | InChI=1S/C14H19N5O2S/c1-3-10-13(22-18-17-10)14(20)16-11-5-6-21-12(11)9-7-15-19(4-2)8-9/h7-8,11-12H,3-6H2,1-2H3,(H,16,20)/t11-,12+/m0/s1 |
| InChIKey | DWGAQVZDSOSWCU-NWDGAFQWSA-N |
| XLogP | 1.58 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide?
The IUPAC name of 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide (CID 129001553) is 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide.
What is the SMILES notation for 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide?
The canonical SMILES for 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide is CCc1nnsc1C(=O)N[C@H]1CCO[C@@H]1c1cnn(CC)c1.
What is the InChIKey of 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide?
The InChIKey is DWGAQVZDSOSWCU-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H19N5O2S/c1-3-10-13(22-18-17-10)14(20)16-11-5-6-21-12(11)9-7-15-19(4-2)8-9/h7-8,11-12H,3-6H2,1-2H3,(H,16,20)/t11-,12+/m0/s1.
What are the key properties of 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide?
4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide has a molecular weight of 321.41 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]thiadiazole-5-carboxamide is sourced from PubChem (CID 129001553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).