About (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one
(E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one (PubChem CID 129001830) has the molecular formula C18H21N3O3
and a molecular weight of 327.38 g/mol. Its IUPAC name is (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one.
Molecular Properties
| Compound Name | (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one |
| PubChem CID | 129001830 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one |
| SMILES | Cc1nnc(C2CN(C(=O)CC/C=C/c3ccccc3)CCO2)o1 |
| InChI | InChI=1S/C18H21N3O3/c1-14-19-20-18(24-14)16-13-21(11-12-23-16)17(22)10-6-5-9-15-7-3-2-4-8-15/h2-5,7-9,16H,6,10-13H2,1H3/b9-5+ |
| InChIKey | GJZFUHHCDGBFKZ-WEVVVXLNSA-N |
| XLogP | 2.77 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one?
The IUPAC name of (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one (CID 129001830) is (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one.
What is the SMILES notation for (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one?
The canonical SMILES for (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one is Cc1nnc(C2CN(C(=O)CC/C=C/c3ccccc3)CCO2)o1.
What is the InChIKey of (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one?
The InChIKey is GJZFUHHCDGBFKZ-WEVVVXLNSA-N. The full InChI is InChI=1S/C18H21N3O3/c1-14-19-20-18(24-14)16-13-21(11-12-23-16)17(22)10-6-5-9-15-7-3-2-4-8-15/h2-5,7-9,16H,6,10-13H2,1H3/b9-5+.
What are the key properties of (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one?
(E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one has a molecular weight of 327.38 g/mol, XLogP of 2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-[2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-5-phenylpent-4-en-1-one is sourced from PubChem (CID 129001830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).