C15H14F3N3O3 — CID 129327013
1-[(2R)-2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-2-(2,4,5-trifluorophenyl)ethanone (PubChem CID 129327013) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-[(2R)-2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-2-(2,4,5-trifluorophenyl)ethanone.
| Compound Name | 1-[(2R)-2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-2-(2,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 129327013 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-[(2R)-2-(5-methyl-1,3,4-oxadiazol-2-yl)morpholin-4-yl]-2-(2,4,5-trifluorophenyl)ethanone |
| SMILES | Cc1nnc([C@H]2CN(C(=O)Cc3cc(F)c(F)cc3F)CCO2)o1 |
| InChI | InChI=1S/C15H14F3N3O3/c1-8-19-20-15(24-8)13-7-21(2-3-23-13)14(22)5-9-4-11(17)12(18)6-10(9)16/h4,6,13H,2-3,5,7H2,1H3/t13-/m1/s1 |
| InChIKey | PLBKNSPOARIIDQ-CYBMUJFWSA-N |
| XLogP | 1.94 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|