C16H21N7OS — CID 129002337
(4R,5S)-1-methyl-4-[(6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)amino]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one (PubChem CID 129002337) has the molecular formula C16H21N7OS and a molecular weight of 359.46 g/mol. Its IUPAC name is (4R,5S)-1-methyl-4-[(6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)amino]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one.
| Compound Name | (4R,5S)-1-methyl-4-[(6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)amino]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 129002337 |
| Molecular Formula | C16H21N7OS |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (4R,5S)-1-methyl-4-[(6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)amino]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one |
| SMILES | Cc1cn2nc(N[C@@H]3CC(=O)N(C)[C@H]3c3c(C)nn(C)c3C)sc2n1 |
| InChI | InChI=1S/C16H21N7OS/c1-8-7-23-16(17-8)25-15(20-23)18-11-6-12(24)21(4)14(11)13-9(2)19-22(5)10(13)3/h7,11,14H,6H2,1-5H3,(H,18,20)/t11-,14-/m1/s1 |
| InChIKey | VZTPSEGILROIFH-BXUZGUMPSA-N |
| XLogP | 1.83 |
| TPSA | 80.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |