About 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one
3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one (PubChem CID 129003384) has the molecular formula C18H22N6O2
and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one |
| PubChem CID | 129003384 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(NCC2CN(Cc3cccc4nccn34)CCO2)c1=O |
| InChI | InChI=1S/C18H22N6O2/c1-22-7-5-20-17(18(22)25)21-11-15-13-23(9-10-26-15)12-14-3-2-4-16-19-6-8-24(14)16/h2-8,15H,9-13H2,1H3,(H,20,21) |
| InChIKey | WQURXVGACCTLKG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one?
The IUPAC name of 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one (CID 129003384) is 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one.
What is the SMILES notation for 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one?
The canonical SMILES for 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one is Cn1ccnc(NCC2CN(Cc3cccc4nccn34)CCO2)c1=O.
What is the InChIKey of 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one?
The InChIKey is WQURXVGACCTLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N6O2/c1-22-7-5-20-17(18(22)25)21-11-15-13-23(9-10-26-15)12-14-3-2-4-16-19-6-8-24(14)16/h2-8,15H,9-13H2,1H3,(H,20,21).
What are the key properties of 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one?
3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one has a molecular weight of 354.41 g/mol, XLogP of 0.74, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(imidazo[1,2-a]pyridin-5-ylmethyl)morpholin-2-yl]methylamino]-1-methylpyrazin-2-one is sourced from PubChem (CID 129003384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).