C17H26N4O3S — CID 129004395
4-[cyclobutyl(methylsulfonyl)amino]-N-pyridin-3-ylazepane-1-carboxamide (PubChem CID 129004395) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is 4-[cyclobutyl(methylsulfonyl)amino]-N-pyridin-3-ylazepane-1-carboxamide.
| Compound Name | 4-[cyclobutyl(methylsulfonyl)amino]-N-pyridin-3-ylazepane-1-carboxamide |
|---|---|
| PubChem CID | 129004395 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 4-[cyclobutyl(methylsulfonyl)amino]-N-pyridin-3-ylazepane-1-carboxamide |
| SMILES | CS(=O)(=O)N(C1CCC1)C1CCCN(C(=O)Nc2cccnc2)CC1 |
| InChI | InChI=1S/C17H26N4O3S/c1-25(23,24)21(15-6-2-7-15)16-8-4-11-20(12-9-16)17(22)19-14-5-3-10-18-13-14/h3,5,10,13,15-16H,2,4,6-9,11-12H2,1H3,(H,19,22) |
| InChIKey | WPEZQCKUOMKPRO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |