C16H27N5O3S — CID 128996295
4-[cyclobutyl(methylsulfonyl)amino]-N-(1-methylpyrazol-3-yl)azepane-1-carboxamide (PubChem CID 128996295) has the molecular formula C16H27N5O3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-[cyclobutyl(methylsulfonyl)amino]-N-(1-methylpyrazol-3-yl)azepane-1-carboxamide.
| Compound Name | 4-[cyclobutyl(methylsulfonyl)amino]-N-(1-methylpyrazol-3-yl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 128996295 |
| Molecular Formula | C16H27N5O3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 4-[cyclobutyl(methylsulfonyl)amino]-N-(1-methylpyrazol-3-yl)azepane-1-carboxamide |
| SMILES | Cn1ccc(NC(=O)N2CCCC(N(C3CCC3)S(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C16H27N5O3S/c1-19-11-9-15(18-19)17-16(22)20-10-4-7-14(8-12-20)21(25(2,23)24)13-5-3-6-13/h9,11,13-14H,3-8,10,12H2,1-2H3,(H,17,18,22) |
| InChIKey | XHOUOVXRFXSNEV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |