C17H28N4O2 — CID 164635885
(4S)-N-(1-cyclohexylpyrazol-3-yl)-4-(hydroxymethyl)azepane-1-carboxamide (PubChem CID 164635885) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is (4S)-N-(1-cyclohexylpyrazol-3-yl)-4-(hydroxymethyl)azepane-1-carboxamide.
| Compound Name | (4S)-N-(1-cyclohexylpyrazol-3-yl)-4-(hydroxymethyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 164635885 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (4S)-N-(1-cyclohexylpyrazol-3-yl)-4-(hydroxymethyl)azepane-1-carboxamide |
| SMILES | O=C(Nc1ccn(C2CCCCC2)n1)N1CCC[C@H](CO)CC1 |
| InChI | InChI=1S/C17H28N4O2/c22-13-14-5-4-10-20(11-8-14)17(23)18-16-9-12-21(19-16)15-6-2-1-3-7-15/h9,12,14-15,22H,1-8,10-11,13H2,(H,18,19,23)/t14-/m0/s1 |
| InChIKey | VSXRUZHMXHLNHZ-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |