C16H26N4O3 — CID 164630590
(3S)-N-(1-cyclohexylpyrazol-3-yl)-3-hydroxy-3-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 164630590) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is (3S)-N-(1-cyclohexylpyrazol-3-yl)-3-hydroxy-3-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | (3S)-N-(1-cyclohexylpyrazol-3-yl)-3-hydroxy-3-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 164630590 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (3S)-N-(1-cyclohexylpyrazol-3-yl)-3-hydroxy-3-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccn(C2CCCCC2)n1)N1CCC[C@@](O)(CO)C1 |
| InChI | InChI=1S/C16H26N4O3/c21-12-16(23)8-4-9-19(11-16)15(22)17-14-7-10-20(18-14)13-5-2-1-3-6-13/h7,10,13,21,23H,1-6,8-9,11-12H2,(H,17,18,22)/t16-/m0/s1 |
| InChIKey | RIOHYICPWIGNLU-INIZCTEOSA-N |
| XLogP | 1.74 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |