C16H26N4O — CID 129330407
3-cyclohexyl-N-[1-[(3R)-pyrrolidin-3-yl]pyrazol-3-yl]propanamide (PubChem CID 129330407) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-cyclohexyl-N-[1-[(3R)-pyrrolidin-3-yl]pyrazol-3-yl]propanamide.
| Compound Name | 3-cyclohexyl-N-[1-[(3R)-pyrrolidin-3-yl]pyrazol-3-yl]propanamide |
|---|---|
| PubChem CID | 129330407 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 3-cyclohexyl-N-[1-[(3R)-pyrrolidin-3-yl]pyrazol-3-yl]propanamide |
| SMILES | O=C(CCC1CCCCC1)Nc1ccn([C@@H]2CCNC2)n1 |
| InChI | InChI=1S/C16H26N4O/c21-16(7-6-13-4-2-1-3-5-13)18-15-9-11-20(19-15)14-8-10-17-12-14/h9,11,13-14,17H,1-8,10,12H2,(H,18,19,21)/t14-/m1/s1 |
| InChIKey | HWYMFJRWGRRWFO-CQSZACIVSA-N |
| XLogP | 2.72 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |