C13H18N6OS — CID 129005216
2-[methyl(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-ylmethyl)amino]-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 129005216) has the molecular formula C13H18N6OS and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[methyl(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-ylmethyl)amino]-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[methyl(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-ylmethyl)amino]-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 129005216 |
| Molecular Formula | C13H18N6OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-[methyl(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-ylmethyl)amino]-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CN(CC(=O)Nc1nncs1)CC1CCc2nccn2C1 |
| InChI | InChI=1S/C13H18N6OS/c1-18(8-12(20)16-13-17-15-9-21-13)6-10-2-3-11-14-4-5-19(11)7-10/h4-5,9-10H,2-3,6-8H2,1H3,(H,16,17,20) |
| InChIKey | ORVRPLHKYVAPHG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |