C14H17F3N6OS — CID 129338421
2-[methyl-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]amino]-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 129338421) has the molecular formula C14H17F3N6OS and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[methyl-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]amino]-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[methyl-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]amino]-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 129338421 |
| Molecular Formula | C14H17F3N6OS |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-[methyl-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]amino]-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CN(CC(=O)Nc1nncs1)C[C@@H]1CCc2nc(C(F)(F)F)cn2C1 |
| InChI | InChI=1S/C14H17F3N6OS/c1-22(7-12(24)20-13-21-18-8-25-13)4-9-2-3-11-19-10(14(15,16)17)6-23(11)5-9/h6,8-9H,2-5,7H2,1H3,(H,20,21,24)/t9-/m0/s1 |
| InChIKey | NAAOZTMWJMEPFQ-VIFPVBQESA-N |
| XLogP | 1.89 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |