C14H17F3N6OS — CID 128966597
1-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]urea (PubChem CID 128966597) has the molecular formula C14H17F3N6OS and a molecular weight of 374.39 g/mol. Its IUPAC name is 1-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]urea.
| Compound Name | 1-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]urea |
|---|---|
| PubChem CID | 128966597 |
| Molecular Formula | C14H17F3N6OS |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-methyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]urea |
| SMILES | Cc1nnc(NC(=O)N(C)CC2CCc3nc(C(F)(F)F)cn3C2)s1 |
| InChI | InChI=1S/C14H17F3N6OS/c1-8-20-21-12(25-8)19-13(24)22(2)5-9-3-4-11-18-10(14(15,16)17)7-23(11)6-9/h7,9H,3-6H2,1-2H3,(H,19,21,24) |
| InChIKey | ORTHJBKZBWAHKZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |