C16H17F3N4O3 — CID 129333834
2-N-methyl-2-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]furan-2,5-dicarboxamide (PubChem CID 129333834) has the molecular formula C16H17F3N4O3 and a molecular weight of 370.33 g/mol. Its IUPAC name is 2-N-methyl-2-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]furan-2,5-dicarboxamide.
| Compound Name | 2-N-methyl-2-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 129333834 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-N-methyl-2-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]furan-2,5-dicarboxamide |
| SMILES | CN(C[C@H]1CCc2nc(C(F)(F)F)cn2C1)C(=O)c1ccc(C(N)=O)o1 |
| InChI | InChI=1S/C16H17F3N4O3/c1-22(15(25)11-4-3-10(26-11)14(20)24)6-9-2-5-13-21-12(16(17,18)19)8-23(13)7-9/h3-4,8-9H,2,5-7H2,1H3,(H2,20,24)/t9-/m1/s1 |
| InChIKey | MWHDERZUUCCQIP-SECBINFHSA-N |
| XLogP | 1.93 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |