C15H25N3O3 — CID 129005878
(2S,3S)-N-(2-ethoxyethyl)-2-(1-ethylpyrazol-4-yl)-N-methyloxolane-3-carboxamide (PubChem CID 129005878) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2S,3S)-N-(2-ethoxyethyl)-2-(1-ethylpyrazol-4-yl)-N-methyloxolane-3-carboxamide.
| Compound Name | (2S,3S)-N-(2-ethoxyethyl)-2-(1-ethylpyrazol-4-yl)-N-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 129005878 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (2S,3S)-N-(2-ethoxyethyl)-2-(1-ethylpyrazol-4-yl)-N-methyloxolane-3-carboxamide |
| SMILES | CCOCCN(C)C(=O)[C@H]1CCO[C@@H]1c1cnn(CC)c1 |
| InChI | InChI=1S/C15H25N3O3/c1-4-18-11-12(10-16-18)14-13(6-8-21-14)15(19)17(3)7-9-20-5-2/h10-11,13-14H,4-9H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | KSYQVAUIZSPWEX-UONOGXRCSA-N |
| XLogP | 1.48 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|