C18H25N3O3 — CID 155955008
[(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-[(2R,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methanone (PubChem CID 155955008) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is [(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-[(2R,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methanone.
| Compound Name | [(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-[(2R,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methanone |
|---|---|
| PubChem CID | 155955008 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | [(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-[(2R,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methanone |
| SMILES | CCn1cc([C@@H]2OCC[C@H]2C(=O)N2C[C@@H]3[C@H](C2)[C@H]2CC[C@@H]3O2)cn1 |
| InChI | InChI=1S/C18H25N3O3/c1-2-21-8-11(7-19-21)17-12(5-6-23-17)18(22)20-9-13-14(10-20)16-4-3-15(13)24-16/h7-8,12-17H,2-6,9-10H2,1H3/t12-,13-,14+,15+,16-,17+/m1/s1 |
| InChIKey | CXCJLYDTHNHTFJ-BPXZUEPWSA-N |
| XLogP | 1.62 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |