About ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate
ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate (PubChem CID 12900627) has the molecular formula C11H20N2O2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate.
Analyze ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate?
The IUPAC name of ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate (CID 12900627) is ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate.
What is the SMILES notation for ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate?
The canonical SMILES for ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate is CCOC(=O)C1CSC2(CCN(C)CC2)N1.
What is the InChIKey of ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate?
The InChIKey is IDNDDXAWSCYSII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2S/c1-3-15-10(14)9-8-16-11(12-9)4-6-13(2)7-5-11/h9,12H,3-8H2,1-2H3.
What are the key properties of ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate?
ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate has a molecular weight of 244.36 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-methyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylate is sourced from PubChem (CID 12900627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).