C11H19NO2S — CID 7388199
(3R)-8-ethyl-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid (PubChem CID 7388199) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is (3R)-8-ethyl-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | (3R)-8-ethyl-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 7388199 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (3R)-8-ethyl-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid |
| SMILES | CCC1CCC2(CC1)N[C@H](C(=O)O)CS2 |
| InChI | InChI=1S/C11H19NO2S/c1-2-8-3-5-11(6-4-8)12-9(7-15-11)10(13)14/h8-9,12H,2-7H2,1H3,(H,13,14)/t8?,9-,11?/m0/s1 |
| InChIKey | ZBZFJJPNXBZWPC-YUCVTWSNSA-N |
| XLogP | 2.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |