C6H9NO4S — CID 10236061
(2S,4S)-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid (PubChem CID 10236061) has the molecular formula C6H9NO4S and a molecular weight of 191.21 g/mol. Its IUPAC name is (2S,4S)-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid.
| Compound Name | (2S,4S)-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 10236061 |
| Molecular Formula | C6H9NO4S |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | (2S,4S)-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid |
| SMILES | C[C@]1(C(=O)O)N[C@@H](C(=O)O)CS1 |
| InChI | InChI=1S/C6H9NO4S/c1-6(5(10)11)7-3(2-12-6)4(8)9/h3,7H,2H2,1H3,(H,8,9)(H,10,11)/t3-,6+/m1/s1 |
| InChIKey | JCAKCGQZNBEITC-CVYQJGLWSA-N |
| XLogP | -0.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |