About 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid
2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid (PubChem CID 76618549) has the molecular formula C7H11NO4S2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid.
Analyze 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid?
The IUPAC name of 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid (CID 76618549) is 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid.
What is the SMILES notation for 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid?
The canonical SMILES for 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid is CSCC1(C(=O)O)NC(C(=O)O)CS1.
What is the InChIKey of 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid?
The InChIKey is CMHXBTNKUUDDTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4S2/c1-13-3-7(6(11)12)8-4(2-14-7)5(9)10/h4,8H,2-3H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid?
2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid has a molecular weight of 237.30 g/mol, XLogP of -0.08, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylsulfanylmethyl)-1,3-thiazolidine-2,4-dicarboxylic acid is sourced from PubChem (CID 76618549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).