C10H18N2O2S — CID 104931208
(3R)-6-ethyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylic acid (PubChem CID 104931208) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is (3R)-6-ethyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | (3R)-6-ethyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 104931208 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (3R)-6-ethyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxylic acid |
| SMILES | CCC1CNCCC12N[C@H](C(=O)O)CS2 |
| InChI | InChI=1S/C10H18N2O2S/c1-2-7-5-11-4-3-10(7)12-8(6-15-10)9(13)14/h7-8,11-12H,2-6H2,1H3,(H,13,14)/t7?,8-,10?/m0/s1 |
| InChIKey | QZESZYMHKHAKQL-ZCUBBSJVSA-N |
| XLogP | 0.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |