C10H20N2S — CID 114510574
6-ethyl-2-methyl-1-thia-4,8-diazaspiro[4.5]decane (PubChem CID 114510574) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 6-ethyl-2-methyl-1-thia-4,8-diazaspiro[4.5]decane.
| Compound Name | 6-ethyl-2-methyl-1-thia-4,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 114510574 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 6-ethyl-2-methyl-1-thia-4,8-diazaspiro[4.5]decane |
| SMILES | CCC1CNCCC12NCC(C)S2 |
| InChI | InChI=1S/C10H20N2S/c1-3-9-7-11-5-4-10(9)12-6-8(2)13-10/h8-9,11-12H,3-7H2,1-2H3 |
| InChIKey | ZOEOERQUHSEHKU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |