C9H18N2S — CID 167067647
2-ethyl-1-thia-4,8-diazaspiro[4.5]decane (PubChem CID 167067647) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane.
| Compound Name | 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 167067647 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane |
| SMILES | CCC1CNC2(CCNCC2)S1 |
| InChI | InChI=1S/C9H18N2S/c1-2-8-7-11-9(12-8)3-5-10-6-4-9/h8,10-11H,2-7H2,1H3 |
| InChIKey | ZWYUKSGLACIWJA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |