About 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane
2-ethyl-1-thia-4,8-diazaspiro[4.5]decane (PubChem CID 167067647) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane |
| PubChem CID | 167067647 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane |
| SMILES | CCC1CNC2(CCNCC2)S1 |
| InChI | InChI=1S/C9H18N2S/c1-2-8-7-11-9(12-8)3-5-10-6-4-9/h8,10-11H,2-7H2,1H3 |
| InChIKey | ZWYUKSGLACIWJA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane?
The IUPAC name of 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane (CID 167067647) is 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane.
What is the SMILES notation for 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane?
The canonical SMILES for 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane is CCC1CNC2(CCNCC2)S1.
What is the InChIKey of 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane?
The InChIKey is ZWYUKSGLACIWJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S/c1-2-8-7-11-9(12-8)3-5-10-6-4-9/h8,10-11H,2-7H2,1H3.
What are the key properties of 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane?
2-ethyl-1-thia-4,8-diazaspiro[4.5]decane has a molecular weight of 186.32 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-thia-4,8-diazaspiro[4.5]decane is sourced from PubChem (CID 167067647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).