About ethane;1-thia-4,8-diazaspiro[4.5]decane
ethane;1-thia-4,8-diazaspiro[4.5]decane (PubChem CID 143985380) has the molecular formula C11H26N2S
and a molecular weight of 218.41 g/mol. Its IUPAC name is ethane;1-thia-4,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | ethane;1-thia-4,8-diazaspiro[4.5]decane |
| PubChem CID | 143985380 |
| Molecular Formula | C11H26N2S |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | ethane;1-thia-4,8-diazaspiro[4.5]decane |
| SMILES | C1CC2(CCN1)NCCS2.CC.CC |
| InChI | InChI=1S/C7H14N2S.2C2H6/c1-3-8-4-2-7(1)9-5-6-10-7;2*1-2/h8-9H,1-6H2;2*1-2H3 |
| InChIKey | ZQZTYIHYTCIWOW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-thia-4,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-thia-4,8-diazaspiro[4.5]decane?
The IUPAC name of ethane;1-thia-4,8-diazaspiro[4.5]decane (CID 143985380) is ethane;1-thia-4,8-diazaspiro[4.5]decane.
What is the SMILES notation for ethane;1-thia-4,8-diazaspiro[4.5]decane?
The canonical SMILES for ethane;1-thia-4,8-diazaspiro[4.5]decane is C1CC2(CCN1)NCCS2.CC.CC.
What is the InChIKey of ethane;1-thia-4,8-diazaspiro[4.5]decane?
The InChIKey is ZQZTYIHYTCIWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S.2C2H6/c1-3-8-4-2-7(1)9-5-6-10-7;2*1-2/h8-9H,1-6H2;2*1-2H3.
What are the key properties of ethane;1-thia-4,8-diazaspiro[4.5]decane?
ethane;1-thia-4,8-diazaspiro[4.5]decane has a molecular weight of 218.41 g/mol, XLogP of 2.45, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-thia-4,8-diazaspiro[4.5]decane is sourced from PubChem (CID 143985380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).